maurice/snix
1
0
Fork 0
Code Issues Pull requests Projects Releases Packages Wiki Activity Actions
snix/absl/time/internal/cctz/src/time_zone_lookup_test.cc
Abseil Team 37dd2562ec Export of internal Abseil changes 
--
8bdb2020150ed0fd4a4e520e454dc5f54e33f776 by Eric Fiselier <ericwf@google.com>:

Workaround bug in GCC 9.2 and after.

PiperOrigin-RevId: 291982551

--
47ff4820e595f96c082a90d733725f6882d83e3b by Abseil Team <absl-team@google.com>:

Improve ABSL_ATTRIBUTE_PACKED documentation

Recommend to apply ABSL_ATTRIBUTE_PACKED to structure members instead of to an entire structure because applying this attribute to an entire structure may cause the compiler to generate suboptimal code. It reduces the alignment of the data structure from a value larger than one to one. When applied to a structure, ABSL_ATTRIBUTE_PACKED reduces the alignment of a structure (alignof()) to 1. As a result, the compiler can no longer assume that e.g. uint32 members are aligned on a four byte boundary and hence is forced to use single-byte load and store instructions on CPU architectures that do not support non-aligned loads or stores.

PiperOrigin-RevId: 291977920

--
902b7a86f860da699d3a2e5c738be5ef73ede3b4 by Mark Barolak <mbar@google.com>:

Internal change

PiperOrigin-RevId: 291963048

--
bb3bd3247e376d53a3080b105f13ec7566d3ae50 by Abseil Team <absl-team@google.com>:

Support the C++17 insert_or_assign() API in btree_map.

PiperOrigin-RevId: 291945474

--
ff3b3cfcbbc64f086f95501f48d49426bcde356f by Gennadiy Rozental <rogeeff@google.com>:

Import of CCTZ from GitHub.

PiperOrigin-RevId: 291861110

--
fd465cd9cbbacd3962f67a7346d6462edaddd809 by Derek Mauro <dmauro@google.com>:

Add flaky=1 to beta_distribution_test.

PiperOrigin-RevId: 291757364

--
3603adfb59c4128c542b670952cce250d59e1f67 by Derek Mauro <dmauro@google.com>:

Separate the initialization of NumCPUs() and NominalCPUFrequency()

The OSS version of Abseil never needs to call NominalCPUFrequency().
In some configurations, initializing NominalCPUFrequency() requires
spending at least 3ms measuring the CPU frequency. By separating the
initialization from NumCPUs(), which is called in most configurations,
we can save at least 3ms of program startup time.

PiperOrigin-RevId: 291737273

--
bea9e4a6bff5a0351d340deab966641867e08c4d by Abseil Team <absl-team@google.com>:

Change the cmake library names not to have a redundant `absl_` prefix.

PiperOrigin-RevId: 291640501

--
501b602ef260cd7c8c527342581ceffb3c5b6d4c by Gennadiy Rozental <rogeeff@google.com>:

Introducing benchmark for absl::GetFlag.

PiperOrigin-RevId: 291433394

--
4eeaddc788da4b91c272a8adca77ca6dbbbc1d44 by Xiaoyi Zhang <zhangxy@google.com>:

fix: Add support for more ARM processors detection

Import of https://github.com/abseil/abseil-cpp/pull/608

PiperOrigin-RevId: 291420397

--
a3087a8e883c5d71de7d9bd4ec8f4db5142dfcf5 by Derek Mauro <dmauro@google.com>:

Removes the flaky raw_hash_set prefetch test

PiperOrigin-RevId: 291197079

--
aad6c2121c102ac36216e771c83227cf3e3bfd66 by Andy Soffer <asoffer@google.com>:

Enable building Abseil as a DLL.
This is currently experimental and unsupported.

This CL does a few things:
1. Adds the ABSL_DLL macro to any class holding a static data member, or to global constants in headers.
2. Adds a whitelist of all files in the DLL and all the build targets that are conglomerated into the DLL.
3. When BUILD_SHARED_LIBS is specified, any build target that would be in the DLL still exists, but we swap out all of it's dependencies so it just depends on abseil_dll

PiperOrigin-RevId: 291192055

--
5e888cd6f2a7722805d41f872108a03a84e421c7 by Mark Barolak <mbar@google.com>:

Move absl/strings/internal/escaping.{cc,h} into internal build targets.

This puts absl/strings/internal/escaping.h behind a whitelist and it also resolves https://github.com/abseil/abseil-cpp/issues/604.

PiperOrigin-RevId: 291173320

--
166836d24970da87587c1728036f53f05a28f0af by Eric Fiselier <ericwf@google.com>:

Internal Change.

PiperOrigin-RevId: 291012718

--
996ddb3dffda02440fa93f30ca5d71b14b688875 by Abseil Team <absl-team@google.com>:

Fix shared libraries log spam for built-in types in absl::GetFlag

PiperOrigin-RevId: 290772743
GitOrigin-RevId: 8bdb2020150ed0fd4a4e520e454dc5f54e33f776
Change-Id: I8bf2265dd14ebbace220a1b6b982bb5040ad2a26
2020-01-28 16:07:41 -05:00

1437 lines
68 KiB
C++
Raw Blame History

// Copyright 2016 Google Inc. All Rights Reserved.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// https://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
#include <chrono>
#include <cstddef>
#include <cstdlib>
#include <future>
#include <limits>
#include <string>
#include <thread>
#include <vector>
#include "gtest/gtest.h"
#include "absl/base/config.h"
#include "absl/time/internal/cctz/include/cctz/civil_time.h"
#include "absl/time/internal/cctz/include/cctz/time_zone.h"
namespace chrono = std::chrono;
namespace absl {
ABSL_NAMESPACE_BEGIN
namespace time_internal {
namespace cctz {
namespace {
// A list of known time-zone names.
const char* const kTimeZoneNames[] = {"Africa/Abidjan",
"Africa/Accra",
"Africa/Addis_Ababa",
"Africa/Algiers",
"Africa/Asmara",
"Africa/Asmera",
"Africa/Bamako",
"Africa/Bangui",
"Africa/Banjul",
"Africa/Bissau",
"Africa/Blantyre",
"Africa/Brazzaville",
"Africa/Bujumbura",
"Africa/Cairo",
"Africa/Casablanca",
"Africa/Ceuta",
"Africa/Conakry",
"Africa/Dakar",
"Africa/Dar_es_Salaam",
"Africa/Djibouti",
"Africa/Douala",
"Africa/El_Aaiun",
"Africa/Freetown",
"Africa/Gaborone",
"Africa/Harare",
"Africa/Johannesburg",
"Africa/Juba",
"Africa/Kampala",
"Africa/Khartoum",
"Africa/Kigali",
"Africa/Kinshasa",
"Africa/Lagos",
"Africa/Libreville",
"Africa/Lome",
"Africa/Luanda",
"Africa/Lubumbashi",
"Africa/Lusaka",
"Africa/Malabo",
"Africa/Maputo",
"Africa/Maseru",
"Africa/Mbabane",
"Africa/Mogadishu",
"Africa/Monrovia",
"Africa/Nairobi",
"Africa/Ndjamena",
"Africa/Niamey",
"Africa/Nouakchott",
"Africa/Ouagadougou",
"Africa/Porto-Novo",
"Africa/Sao_Tome",
"Africa/Timbuktu",
"Africa/Tripoli",
"Africa/Tunis",
"Africa/Windhoek",
"America/Adak",
"America/Anchorage",
"America/Anguilla",
"America/Antigua",
"America/Araguaina",
"America/Argentina/Buenos_Aires",
"America/Argentina/Catamarca",
"America/Argentina/ComodRivadavia",
"America/Argentina/Cordoba",
"America/Argentina/Jujuy",
"America/Argentina/La_Rioja",
"America/Argentina/Mendoza",
"America/Argentina/Rio_Gallegos",
"America/Argentina/Salta",
"America/Argentina/San_Juan",
"America/Argentina/San_Luis",
"America/Argentina/Tucuman",
"America/Argentina/Ushuaia",
"America/Aruba",
"America/Asuncion",
"America/Atikokan",
"America/Atka",
"America/Bahia",
"America/Bahia_Banderas",
"America/Barbados",
"America/Belem",
"America/Belize",
"America/Blanc-Sablon",
"America/Boa_Vista",
"America/Bogota",
"America/Boise",
"America/Buenos_Aires",
"America/Cambridge_Bay",
"America/Campo_Grande",
"America/Cancun",
"America/Caracas",
"America/Catamarca",
"America/Cayenne",
"America/Cayman",
"America/Chicago",
"America/Chihuahua",
"America/Coral_Harbour",
"America/Cordoba",
"America/Costa_Rica",
"America/Creston",
"America/Cuiaba",
"America/Curacao",
"America/Danmarkshavn",
"America/Dawson",
"America/Dawson_Creek",
"America/Denver",
"America/Detroit",
"America/Dominica",
"America/Edmonton",
"America/Eirunepe",
"America/El_Salvador",
"America/Ensenada",
"America/Fort_Nelson",
"America/Fort_Wayne",
"America/Fortaleza",
"America/Glace_Bay",
"America/Godthab",
"America/Goose_Bay",
"America/Grand_Turk",
"America/Grenada",
"America/Guadeloupe",
"America/Guatemala",
"America/Guayaquil",
"America/Guyana",
"America/Halifax",
"America/Havana",
"America/Hermosillo",
"America/Indiana/Indianapolis",
"America/Indiana/Knox",
"America/Indiana/Marengo",
"America/Indiana/Petersburg",
"America/Indiana/Tell_City",
"America/Indiana/Vevay",
"America/Indiana/Vincennes",
"America/Indiana/Winamac",
"America/Indianapolis",
"America/Inuvik",
"America/Iqaluit",
"America/Jamaica",
"America/Jujuy",
"America/Juneau",
"America/Kentucky/Louisville",
"America/Kentucky/Monticello",
"America/Knox_IN",
"America/Kralendijk",
"America/La_Paz",
"America/Lima",
"America/Los_Angeles",
"America/Louisville",
"America/Lower_Princes",
"America/Maceio",
"America/Managua",
"America/Manaus",
"America/Marigot",
"America/Martinique",
"America/Matamoros",
"America/Mazatlan",
"America/Mendoza",
"America/Menominee",
"America/Merida",
"America/Metlakatla",
"America/Mexico_City",
"America/Miquelon",
"America/Moncton",
"America/Monterrey",
"America/Montevideo",
"America/Montreal",
"America/Montserrat",
"America/Nassau",
"America/New_York",
"America/Nipigon",
"America/Nome",
"America/Noronha",
"America/North_Dakota/Beulah",
"America/North_Dakota/Center",
"America/North_Dakota/New_Salem",
"America/Ojinaga",
"America/Panama",
"America/Pangnirtung",
"America/Paramaribo",
"America/Phoenix",
"America/Port-au-Prince",
"America/Port_of_Spain",
"America/Porto_Acre",
"America/Porto_Velho",
"America/Puerto_Rico",
"America/Punta_Arenas",
"America/Rainy_River",
"America/Rankin_Inlet",
"America/Recife",
"America/Regina",
"America/Resolute",
"America/Rio_Branco",
"America/Rosario",
"America/Santa_Isabel",
"America/Santarem",
"America/Santiago",
"America/Santo_Domingo",
"America/Sao_Paulo",
"America/Scoresbysund",
"America/Shiprock",
"America/Sitka",
"America/St_Barthelemy",
"America/St_Johns",
"America/St_Kitts",
"America/St_Lucia",
"America/St_Thomas",
"America/St_Vincent",
"America/Swift_Current",
"America/Tegucigalpa",
"America/Thule",
"America/Thunder_Bay",
"America/Tijuana",
"America/Toronto",
"America/Tortola",
"America/Vancouver",
"America/Virgin",
"America/Whitehorse",
"America/Winnipeg",
"America/Yakutat",
"America/Yellowknife",
"Antarctica/Casey",
"Antarctica/Davis",
"Antarctica/DumontDUrville",
"Antarctica/Macquarie",
"Antarctica/Mawson",
"Antarctica/McMurdo",
"Antarctica/Palmer",
"Antarctica/Rothera",
"Antarctica/South_Pole",
"Antarctica/Syowa",
"Antarctica/Troll",
"Antarctica/Vostok",
"Arctic/Longyearbyen",
"Asia/Aden",
"Asia/Almaty",
"Asia/Amman",
"Asia/Anadyr",
"Asia/Aqtau",
"Asia/Aqtobe",
"Asia/Ashgabat",
"Asia/Ashkhabad",
"Asia/Atyrau",
"Asia/Baghdad",
"Asia/Bahrain",
"Asia/Baku",
"Asia/Bangkok",
"Asia/Barnaul",
"Asia/Beirut",
"Asia/Bishkek",
"Asia/Brunei",
"Asia/Calcutta",
"Asia/Chita",
"Asia/Choibalsan",
"Asia/Chongqing",
"Asia/Chungking",
"Asia/Colombo",
"Asia/Dacca",
"Asia/Damascus",
"Asia/Dhaka",
"Asia/Dili",
"Asia/Dubai",
"Asia/Dushanbe",
"Asia/Famagusta",
"Asia/Gaza",
"Asia/Harbin",
"Asia/Hebron",
"Asia/Ho_Chi_Minh",
"Asia/Hong_Kong",
"Asia/Hovd",
"Asia/Irkutsk",
"Asia/Istanbul",
"Asia/Jakarta",
"Asia/Jayapura",
"Asia/Jerusalem",
"Asia/Kabul",
"Asia/Kamchatka",
"Asia/Karachi",
"Asia/Kashgar",
"Asia/Kathmandu",
"Asia/Katmandu",
"Asia/Khandyga",
"Asia/Kolkata",
"Asia/Krasnoyarsk",
"Asia/Kuala_Lumpur",
"Asia/Kuching",
"Asia/Kuwait",
"Asia/Macao",
"Asia/Macau",
"Asia/Magadan",
"Asia/Makassar",
"Asia/Manila",
"Asia/Muscat",
"Asia/Nicosia",
"Asia/Novokuznetsk",
"Asia/Novosibirsk",
"Asia/Omsk",
"Asia/Oral",
"Asia/Phnom_Penh",
"Asia/Pontianak",
"Asia/Pyongyang",
"Asia/Qatar",
"Asia/Qostanay",
"Asia/Qyzylorda",
"Asia/Rangoon",
"Asia/Riyadh",
"Asia/Saigon",
"Asia/Sakhalin",
"Asia/Samarkand",
"Asia/Seoul",
"Asia/Shanghai",
"Asia/Singapore",
"Asia/Srednekolymsk",
"Asia/Taipei",
"Asia/Tashkent",
"Asia/Tbilisi",
"Asia/Tehran",
"Asia/Tel_Aviv",
"Asia/Thimbu",
"Asia/Thimphu",
"Asia/Tokyo",
"Asia/Tomsk",
"Asia/Ujung_Pandang",
"Asia/Ulaanbaatar",
"Asia/Ulan_Bator",
"Asia/Urumqi",
"Asia/Ust-Nera",
"Asia/Vientiane",
"Asia/Vladivostok",
"Asia/Yakutsk",
"Asia/Yangon",
"Asia/Yekaterinburg",
"Asia/Yerevan",
"Atlantic/Azores",
"Atlantic/Bermuda",
"Atlantic/Canary",
"Atlantic/Cape_Verde",
"Atlantic/Faeroe",
"Atlantic/Faroe",
"Atlantic/Jan_Mayen",
"Atlantic/Madeira",
"Atlantic/Reykjavik",
"Atlantic/South_Georgia",
"Atlantic/St_Helena",
"Atlantic/Stanley",
"Australia/ACT",
"Australia/Adelaide",
"Australia/Brisbane",
"Australia/Broken_Hill",
"Australia/Canberra",
"Australia/Currie",
"Australia/Darwin",
"Australia/Eucla",
"Australia/Hobart",
"Australia/LHI",
"Australia/Lindeman",
"Australia/Lord_Howe",
"Australia/Melbourne",
"Australia/NSW",
"Australia/North",
"Australia/Perth",
"Australia/Queensland",
"Australia/South",
"Australia/Sydney",
"Australia/Tasmania",
"Australia/Victoria",
"Australia/West",
"Australia/Yancowinna",
"Brazil/Acre",
"Brazil/DeNoronha",
"Brazil/East",
"Brazil/West",
"CET",
"CST6CDT",
"Canada/Atlantic",
"Canada/Central",
"Canada/Eastern",
"Canada/Mountain",
"Canada/Newfoundland",
"Canada/Pacific",
"Canada/Saskatchewan",
"Canada/Yukon",
"Chile/Continental",
"Chile/EasterIsland",
"Cuba",
"EET",
"EST",
"EST5EDT",
"Egypt",
"Eire",
"Etc/GMT",
"Etc/GMT+0",
"Etc/GMT+1",
"Etc/GMT+10",
"Etc/GMT+11",
"Etc/GMT+12",
"Etc/GMT+2",
"Etc/GMT+3",
"Etc/GMT+4",
"Etc/GMT+5",
"Etc/GMT+6",
"Etc/GMT+7",
"Etc/GMT+8",
"Etc/GMT+9",
"Etc/GMT-0",
"Etc/GMT-1",
"Etc/GMT-10",
"Etc/GMT-11",
"Etc/GMT-12",
"Etc/GMT-13",
"Etc/GMT-14",
"Etc/GMT-2",
"Etc/GMT-3",
"Etc/GMT-4",
"Etc/GMT-5",
"Etc/GMT-6",
"Etc/GMT-7",
"Etc/GMT-8",
"Etc/GMT-9",
"Etc/GMT0",
"Etc/Greenwich",
"Etc/UCT",
"Etc/UTC",
"Etc/Universal",
"Etc/Zulu",
"Europe/Amsterdam",
"Europe/Andorra",
"Europe/Astrakhan",
"Europe/Athens",
"Europe/Belfast",
"Europe/Belgrade",
"Europe/Berlin",
"Europe/Bratislava",
"Europe/Brussels",
"Europe/Bucharest",
"Europe/Budapest",
"Europe/Busingen",
"Europe/Chisinau",
"Europe/Copenhagen",
"Europe/Dublin",
"Europe/Gibraltar",
"Europe/Guernsey",
"Europe/Helsinki",
"Europe/Isle_of_Man",
"Europe/Istanbul",
"Europe/Jersey",
"Europe/Kaliningrad",
"Europe/Kiev",
"Europe/Kirov",
"Europe/Lisbon",
"Europe/Ljubljana",
"Europe/London",
"Europe/Luxembourg",
"Europe/Madrid",
"Europe/Malta",
"Europe/Mariehamn",
"Europe/Minsk",
"Europe/Monaco",
"Europe/Moscow",
"Europe/Nicosia",
"Europe/Oslo",
"Europe/Paris",
"Europe/Podgorica",
"Europe/Prague",
"Europe/Riga",
"Europe/Rome",
"Europe/Samara",
"Europe/San_Marino",
"Europe/Sarajevo",
"Europe/Saratov",
"Europe/Simferopol",
"Europe/Skopje",
"Europe/Sofia",
"Europe/Stockholm",
"Europe/Tallinn",
"Europe/Tirane",
"Europe/Tiraspol",
"Europe/Ulyanovsk",
"Europe/Uzhgorod",
"Europe/Vaduz",
"Europe/Vatican",
"Europe/Vienna",
"Europe/Vilnius",
"Europe/Volgograd",
"Europe/Warsaw",
"Europe/Zagreb",
"Europe/Zaporozhye",
"Europe/Zurich",
"GB",
"GB-Eire",
"GMT",
"GMT+0",
"GMT-0",
"GMT0",
"Greenwich",
"HST",
"Hongkong",
"Iceland",
"Indian/Antananarivo",
"Indian/Chagos",
"Indian/Christmas",
"Indian/Cocos",
"Indian/Comoro",
"Indian/Kerguelen",
"Indian/Mahe",
"Indian/Maldives",
"Indian/Mauritius",
"Indian/Mayotte",
"Indian/Reunion",
"Iran",
"Israel",
"Jamaica",
"Japan",
"Kwajalein",
"Libya",
"MET",
"MST",
"MST7MDT",
"Mexico/BajaNorte",
"Mexico/BajaSur",
"Mexico/General",
"NZ",
"NZ-CHAT",
"Navajo",
"PRC",
"PST8PDT",
"Pacific/Apia",
"Pacific/Auckland",
"Pacific/Bougainville",
"Pacific/Chatham",
"Pacific/Chuuk",
"Pacific/Easter",
"Pacific/Efate",
"Pacific/Enderbury",
"Pacific/Fakaofo",
"Pacific/Fiji",
"Pacific/Funafuti",
"Pacific/Galapagos",
"Pacific/Gambier",
"Pacific/Guadalcanal",
"Pacific/Guam",
"Pacific/Honolulu",
"Pacific/Johnston",
"Pacific/Kiritimati",
"Pacific/Kosrae",
"Pacific/Kwajalein",
"Pacific/Majuro",
"Pacific/Marquesas",
"Pacific/Midway",
"Pacific/Nauru",
"Pacific/Niue",
"Pacific/Norfolk",
"Pacific/Noumea",
"Pacific/Pago_Pago",
"Pacific/Palau",
"Pacific/Pitcairn",
"Pacific/Pohnpei",
"Pacific/Ponape",
"Pacific/Port_Moresby",
"Pacific/Rarotonga",
"Pacific/Saipan",
"Pacific/Samoa",
"Pacific/Tahiti",
"Pacific/Tarawa",
"Pacific/Tongatapu",
"Pacific/Truk",
"Pacific/Wake",
"Pacific/Wallis",
"Pacific/Yap",
"Poland",
"Portugal",
"ROC",
"ROK",
"Singapore",
"Turkey",
"UCT",
"US/Alaska",
"US/Aleutian",
"US/Arizona",
"US/Central",
"US/East-Indiana",
"US/Eastern",
"US/Hawaii",
"US/Indiana-Starke",
"US/Michigan",
"US/Mountain",
"US/Pacific",
"US/Samoa",
"UTC",
"Universal",
"W-SU",
"WET",
"Zulu",
nullptr};
// Helper to return a loaded time zone by value (UTC on error).
time_zone LoadZone(const std::string& name) {
time_zone tz;
load_time_zone(name, &tz);
return tz;
}
// This helper is a macro so that failed expectations show up with the
// correct line numbers.
#define ExpectTime(tp, tz, y, m, d, hh, mm, ss, off, isdst, zone) \
do { \
time_zone::absolute_lookup al = tz.lookup(tp); \
EXPECT_EQ(y, al.cs.year()); \
EXPECT_EQ(m, al.cs.month()); \
EXPECT_EQ(d, al.cs.day()); \
EXPECT_EQ(hh, al.cs.hour()); \
EXPECT_EQ(mm, al.cs.minute()); \
EXPECT_EQ(ss, al.cs.second()); \
EXPECT_EQ(off, al.offset); \
EXPECT_TRUE(isdst == al.is_dst); \
/* EXPECT_STREQ(zone, al.abbr); */ \
} while (0)
// These tests sometimes run on platforms that have zoneinfo data so old
// that the transition we are attempting to check does not exist, most
// notably Android emulators. Fortunately, AndroidZoneInfoSource supports
// time_zone::version() so, in cases where we've learned that it matters,
// we can make the check conditionally.
int VersionCmp(time_zone tz, const std::string& target) {
std::string version = tz.version();
if (version.empty() && !target.empty()) return 1; // unknown > known
return version.compare(target);
}
} // namespace
#if !defined(__EMSCRIPTEN__)
TEST(TimeZones, LoadZonesConcurrently) {
std::promise<void> ready_promise;
std::shared_future<void> ready_future(ready_promise.get_future());
auto load_zones = [ready_future](std::promise<void>* started,
std::set<std::string>* failures) {
started->set_value();
ready_future.wait();
for (const char* const* np = kTimeZoneNames; *np != nullptr; ++np) {
std::string zone = *np;
time_zone tz;
if (load_time_zone(zone, &tz)) {
EXPECT_EQ(zone, tz.name());
} else {
failures->insert(zone);
}
}
};
const std::size_t n_threads = 128;
std::vector<std::thread> threads;
std::vector<std::set<std::string>> thread_failures(n_threads);
for (std::size_t i = 0; i != n_threads; ++i) {
std::promise<void> started;
threads.emplace_back(load_zones, &started, &thread_failures[i]);
started.get_future().wait();
}
ready_promise.set_value();
for (auto& thread : threads) {
thread.join();
}
// Allow a small number of failures to account for skew between
// the contents of kTimeZoneNames and the zoneinfo data source.
#if defined(__ANDROID__)
// Cater to the possibility of using an even older zoneinfo data
// source when running on Android, where it is difficult to override
// the bionic tzdata provided by the test environment.
const std::size_t max_failures = 20;
#else
const std::size_t max_failures = 3;
#endif
std::set<std::string> failures;
for (const auto& thread_failure : thread_failures) {
failures.insert(thread_failure.begin(), thread_failure.end());
}
EXPECT_LE(failures.size(), max_failures) << testing::PrintToString(failures);
}
#endif
TEST(TimeZone, NamedTimeZones) {
const time_zone utc = utc_time_zone();
EXPECT_EQ("UTC", utc.name());
const time_zone nyc = LoadZone("America/New_York");
EXPECT_EQ("America/New_York", nyc.name());
const time_zone syd = LoadZone("Australia/Sydney");
EXPECT_EQ("Australia/Sydney", syd.name());
const time_zone fixed0 =
fixed_time_zone(absl::time_internal::cctz::seconds::zero());
EXPECT_EQ("UTC", fixed0.name());
const time_zone fixed_pos = fixed_time_zone(
chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
EXPECT_EQ("Fixed/UTC+03:25:45", fixed_pos.name());
const time_zone fixed_neg = fixed_time_zone(
-(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
EXPECT_EQ("Fixed/UTC-12:34:56", fixed_neg.name());
}
TEST(TimeZone, Failures) {
time_zone tz;
EXPECT_FALSE(load_time_zone(":America/Los_Angeles", &tz));
tz = LoadZone("America/Los_Angeles");
EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
EXPECT_EQ(chrono::system_clock::from_time_t(0),
convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
// Ensures that the load still fails on a subsequent attempt.
tz = LoadZone("America/Los_Angeles");
EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
EXPECT_EQ(chrono::system_clock::from_time_t(0),
convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
// Loading an empty std::string timezone should fail.
tz = LoadZone("America/Los_Angeles");
EXPECT_FALSE(load_time_zone("", &tz));
EXPECT_EQ(chrono::system_clock::from_time_t(0),
convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
}
TEST(TimeZone, Equality) {
const time_zone a;
const time_zone b;
EXPECT_EQ(a, b);
EXPECT_EQ(a.name(), b.name());
const time_zone implicit_utc;
const time_zone explicit_utc = utc_time_zone();
EXPECT_EQ(implicit_utc, explicit_utc);
EXPECT_EQ(implicit_utc.name(), explicit_utc.name());
const time_zone fixed_zero =
fixed_time_zone(absl::time_internal::cctz::seconds::zero());
EXPECT_EQ(fixed_zero, LoadZone(fixed_zero.name()));
EXPECT_EQ(fixed_zero, explicit_utc);
const time_zone fixed_utc = LoadZone("Fixed/UTC+00:00:00");
EXPECT_EQ(fixed_utc, LoadZone(fixed_utc.name()));
EXPECT_EQ(fixed_utc, explicit_utc);
const time_zone fixed_pos = fixed_time_zone(
chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
EXPECT_EQ(fixed_pos, LoadZone(fixed_pos.name()));
EXPECT_NE(fixed_pos, explicit_utc);
const time_zone fixed_neg = fixed_time_zone(
-(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
EXPECT_EQ(fixed_neg, LoadZone(fixed_neg.name()));
EXPECT_NE(fixed_neg, explicit_utc);
const time_zone fixed_lim = fixed_time_zone(chrono::hours(24));
EXPECT_EQ(fixed_lim, LoadZone(fixed_lim.name()));
EXPECT_NE(fixed_lim, explicit_utc);
const time_zone fixed_ovfl =
fixed_time_zone(chrono::hours(24) + chrono::seconds(1));
EXPECT_EQ(fixed_ovfl, LoadZone(fixed_ovfl.name()));
EXPECT_EQ(fixed_ovfl, explicit_utc);
EXPECT_EQ(fixed_time_zone(chrono::seconds(1)),
fixed_time_zone(chrono::seconds(1)));
const time_zone local = local_time_zone();
EXPECT_EQ(local, LoadZone(local.name()));
time_zone la = LoadZone("America/Los_Angeles");
time_zone nyc = LoadZone("America/New_York");
EXPECT_NE(la, nyc);
}
TEST(StdChronoTimePoint, TimeTAlignment) {
// Ensures that the Unix epoch and the system clock epoch are an integral
// number of seconds apart. This simplifies conversions to/from time_t.
auto diff =
chrono::system_clock::time_point() - chrono::system_clock::from_time_t(0);
EXPECT_EQ(chrono::system_clock::time_point::duration::zero(),
diff % chrono::seconds(1));
}
TEST(BreakTime, TimePointResolution) {
const time_zone utc = utc_time_zone();
const auto t0 = chrono::system_clock::from_time_t(0);
ExpectTime(chrono::time_point_cast<chrono::nanoseconds>(t0), utc, 1970, 1, 1,
0, 0, 0, 0, false, "UTC");
ExpectTime(chrono::time_point_cast<chrono::microseconds>(t0), utc, 1970, 1, 1,
0, 0, 0, 0, false, "UTC");
ExpectTime(chrono::time_point_cast<chrono::milliseconds>(t0), utc, 1970, 1, 1,
0, 0, 0, 0, false, "UTC");
ExpectTime(chrono::time_point_cast<chrono::seconds>(t0), utc, 1970, 1, 1, 0,
0, 0, 0, false, "UTC");
ExpectTime(chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0),
utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC");
ExpectTime(chrono::time_point_cast<chrono::minutes>(t0), utc, 1970, 1, 1, 0,
0, 0, 0, false, "UTC");
ExpectTime(chrono::time_point_cast<chrono::hours>(t0), utc, 1970, 1, 1, 0, 0,
0, 0, false, "UTC");
}
TEST(BreakTime, LocalTimeInUTC) {
const time_zone tz = utc_time_zone();
const auto tp = chrono::system_clock::from_time_t(0);
ExpectTime(tp, tz, 1970, 1, 1, 0, 0, 0, 0, false, "UTC");
EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
}
TEST(BreakTime, LocalTimeInUTCUnaligned) {
const time_zone tz = utc_time_zone();
const auto tp =
chrono::system_clock::from_time_t(0) - chrono::milliseconds(500);
ExpectTime(tp, tz, 1969, 12, 31, 23, 59, 59, 0, false, "UTC");
EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
}
TEST(BreakTime, LocalTimePosix) {
// See IEEE Std 1003.1-1988 B.2.3 General Terms, Epoch.
const time_zone tz = utc_time_zone();
const auto tp = chrono::system_clock::from_time_t(536457599);
ExpectTime(tp, tz, 1986, 12, 31, 23, 59, 59, 0, false, "UTC");
EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
}
TEST(TimeZoneImpl, LocalTimeInFixed) {
const absl::time_internal::cctz::seconds offset =
-(chrono::hours(8) + chrono::minutes(33) + chrono::seconds(47));
const time_zone tz = fixed_time_zone(offset);
const auto tp = chrono::system_clock::from_time_t(0);
ExpectTime(tp, tz, 1969, 12, 31, 15, 26, 13, offset.count(), false,
"-083347");
EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
}
TEST(BreakTime, LocalTimeInNewYork) {
const time_zone tz = LoadZone("America/New_York");
const auto tp = chrono::system_clock::from_time_t(45);
ExpectTime(tp, tz, 1969, 12, 31, 19, 0, 45, -5 * 60 * 60, false, "EST");
EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
}
TEST(BreakTime, LocalTimeInMTV) {
const time_zone tz = LoadZone("America/Los_Angeles");
const auto tp = chrono::system_clock::from_time_t(1380855729);
ExpectTime(tp, tz, 2013, 10, 3, 20, 2, 9, -7 * 60 * 60, true, "PDT");
EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
}
TEST(BreakTime, LocalTimeInSydney) {
const time_zone tz = LoadZone("Australia/Sydney");
const auto tp = chrono::system_clock::from_time_t(90);
ExpectTime(tp, tz, 1970, 1, 1, 10, 1, 30, 10 * 60 * 60, false, "AEST");
EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
}
TEST(MakeTime, TimePointResolution) {
const time_zone utc = utc_time_zone();
const time_point<chrono::nanoseconds> tp_ns =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_ns, utc));
const time_point<chrono::microseconds> tp_us =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_us, utc));
const time_point<chrono::milliseconds> tp_ms =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_ms, utc));
const time_point<chrono::seconds> tp_s =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_s, utc));
const time_point<absl::time_internal::cctz::seconds> tp_s64 =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_s64, utc));
// These next two require chrono::time_point_cast because the conversion
// from a resolution of seconds (the return value of convert()) to a
// coarser resolution requires an explicit cast.
const time_point<chrono::minutes> tp_m =
chrono::time_point_cast<chrono::minutes>(
convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
EXPECT_EQ("04:00", format("%M:%E*S", tp_m, utc));
const time_point<chrono::hours> tp_h = chrono::time_point_cast<chrono::hours>(
convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
EXPECT_EQ("00:00", format("%M:%E*S", tp_h, utc));
}
TEST(MakeTime, Normalization) {
const time_zone tz = LoadZone("America/New_York");
const auto tp = convert(civil_second(2009, 2, 13, 18, 31, 30), tz);
EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
// Now requests for the same time_point but with out-of-range fields.
EXPECT_EQ(tp, convert(civil_second(2008, 14, 13, 18, 31, 30), tz)); // month
EXPECT_EQ(tp, convert(civil_second(2009, 1, 44, 18, 31, 30), tz)); // day
EXPECT_EQ(tp, convert(civil_second(2009, 2, 12, 42, 31, 30), tz)); // hour
EXPECT_EQ(tp, convert(civil_second(2009, 2, 13, 17, 91, 30), tz)); // minute
EXPECT_EQ(tp, convert(civil_second(2009, 2, 13, 18, 30, 90), tz)); // second
}
// NOTE: Run this with -ftrapv to detect overflow problems.
TEST(MakeTime, SysSecondsLimits) {
const char RFC3339[] = "%Y-%m-%dT%H:%M:%S%Ez";
const time_zone utc = utc_time_zone();
const time_zone east = fixed_time_zone(chrono::hours(14));
const time_zone west = fixed_time_zone(-chrono::hours(14));
time_point<absl::time_internal::cctz::seconds> tp;
// Approach the maximal time_point<cctz::seconds> value from below.
tp = convert(civil_second(292277026596, 12, 4, 15, 30, 6), utc);
EXPECT_EQ("292277026596-12-04T15:30:06+00:00", format(RFC3339, tp, utc));
tp = convert(civil_second(292277026596, 12, 4, 15, 30, 7), utc);
EXPECT_EQ("292277026596-12-04T15:30:07+00:00", format(RFC3339, tp, utc));
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second(292277026596, 12, 4, 15, 30, 8), utc);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second::max(), utc);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
// Checks that we can also get the maximal value for a far-east zone.
tp = convert(civil_second(292277026596, 12, 5, 5, 30, 7), east);
EXPECT_EQ("292277026596-12-05T05:30:07+14:00", format(RFC3339, tp, east));
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second(292277026596, 12, 5, 5, 30, 8), east);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second::max(), east);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
// Checks that we can also get the maximal value for a far-west zone.
tp = convert(civil_second(292277026596, 12, 4, 1, 30, 7), west);
EXPECT_EQ("292277026596-12-04T01:30:07-14:00", format(RFC3339, tp, west));
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second(292277026596, 12, 4, 7, 30, 8), west);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second::max(), west);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
// Approach the minimal time_point<cctz::seconds> value from above.
tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 53), utc);
EXPECT_EQ("-292277022657-01-27T08:29:53+00:00", format(RFC3339, tp, utc));
tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 52), utc);
EXPECT_EQ("-292277022657-01-27T08:29:52+00:00", format(RFC3339, tp, utc));
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 51), utc);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second::min(), utc);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
// Checks that we can also get the minimal value for a far-east zone.
tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 52), east);
EXPECT_EQ("-292277022657-01-27T22:29:52+14:00", format(RFC3339, tp, east));
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 51), east);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second::min(), east);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
// Checks that we can also get the minimal value for a far-west zone.
tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 52), west);
EXPECT_EQ("-292277022657-01-26T18:29:52-14:00", format(RFC3339, tp, west));
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 51), west);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second::min(), west);
EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
// Some similar checks for the "libc" time-zone implementation.
if (sizeof(std::time_t) >= 8) {
// Checks that "tm_year + 1900", as used by the "libc" implementation,
// can produce year values beyond the range on an int without overflow.
#if defined(_WIN32) || defined(_WIN64)
// localtime_s() and gmtime_s() don't believe in years outside [1970:3000].
#else
const time_zone utc = LoadZone("libc:UTC");
const year_t max_tm_year = year_t{std::numeric_limits<int>::max()} + 1900;
tp = convert(civil_second(max_tm_year, 12, 31, 23, 59, 59), utc);
EXPECT_EQ("2147485547-12-31T23:59:59+00:00", format(RFC3339, tp, utc));
const year_t min_tm_year = year_t{std::numeric_limits<int>::min()} + 1900;
tp = convert(civil_second(min_tm_year, 1, 1, 0, 0, 0), utc);
EXPECT_EQ("-2147481748-01-01T00:00:00+00:00", format(RFC3339, tp, utc));
#endif
}
}
TEST(MakeTime, LocalTimeLibC) {
// Checks that cctz and libc agree on transition points in [1970:2037].
//
// We limit this test case to environments where:
// 1) we know how to change the time zone used by localtime()/mktime(),
// 2) cctz and localtime()/mktime() will use similar-enough tzdata, and
// 3) we have some idea about how mktime() behaves during transitions.
#if defined(__linux__) && !defined(__ANDROID__)
const char* const ep = getenv("TZ");
std::string tz_name = (ep != nullptr) ? ep : "";
for (const char* const* np = kTimeZoneNames; *np != nullptr; ++np) {
ASSERT_EQ(0, setenv("TZ", *np, 1)); // change what "localtime" means
const auto zi = local_time_zone();
const auto lc = LoadZone("libc:localtime");
time_zone::civil_transition transition;
for (auto tp = zi.lookup(civil_second()).trans;
zi.next_transition(tp, &transition);
tp = zi.lookup(transition.to).trans) {
const auto fcl = zi.lookup(transition.from);
const auto tcl = zi.lookup(transition.to);
civil_second cs; // compare cs in zi and lc
if (fcl.kind == time_zone::civil_lookup::UNIQUE) {
if (tcl.kind == time_zone::civil_lookup::UNIQUE) {
// Both unique; must be an is_dst or abbr change.
ASSERT_EQ(transition.from, transition.to);
const auto trans = fcl.trans;
const auto tal = zi.lookup(trans);
const auto tprev = trans - absl::time_internal::cctz::seconds(1);
const auto pal = zi.lookup(tprev);
if (pal.is_dst == tal.is_dst) {
ASSERT_STRNE(pal.abbr, tal.abbr);
}
continue;
}
ASSERT_EQ(time_zone::civil_lookup::REPEATED, tcl.kind);
cs = transition.to;
} else {
ASSERT_EQ(time_zone::civil_lookup::UNIQUE, tcl.kind);
ASSERT_EQ(time_zone::civil_lookup::SKIPPED, fcl.kind);
cs = transition.from;
}
if (cs.year() > 2037) break; // limit test time (and to 32-bit time_t)
const auto cl_zi = zi.lookup(cs);
if (zi.lookup(cl_zi.pre).is_dst == zi.lookup(cl_zi.post).is_dst) {
// The "libc" implementation cannot correctly classify transitions
// that don't change the "tm_isdst" flag. In Europe/Volgograd, for
// example, there is a SKIPPED transition from +03 to +04 with dst=F
// on both sides ...
// 1540681199 = 2018-10-28 01:59:59 +03:00:00 [dst=F off=10800]
// 1540681200 = 2018-10-28 03:00:00 +04:00:00 [dst=F off=14400]
// but std::mktime(2018-10-28 02:00:00, tm_isdst=0) fails, unlike,
// say, the similar Europe/Chisinau transition from +02 to +03 ...
// 1521935999 = 2018-03-25 01:59:59 +02:00:00 [dst=F off=7200]
// 1521936000 = 2018-03-25 03:00:00 +03:00:00 [dst=T off=10800]
// where std::mktime(2018-03-25 02:00:00, tm_isdst=0) succeeds and
// returns 1521936000.
continue;
}
if (cs == civil_second(2037, 10, 4, 2, 0, 0)) {
const std::string tzname = *np;
if (tzname == "Africa/Casablanca" || tzname == "Africa/El_Aaiun") {
// The "libc" implementation gets this transition wrong (at least
// until 2018g when it was removed), returning an offset of 3600
// instead of 0. TODO: Revert this when 2018g is ubiquitous.
continue;
}
}
const auto cl_lc = lc.lookup(cs);
SCOPED_TRACE(testing::Message() << "For " << cs << " in " << *np);
EXPECT_EQ(cl_zi.kind, cl_lc.kind);
EXPECT_EQ(cl_zi.pre, cl_lc.pre);
EXPECT_EQ(cl_zi.trans, cl_lc.trans);
EXPECT_EQ(cl_zi.post, cl_lc.post);
}
}
if (ep == nullptr) {
ASSERT_EQ(0, unsetenv("TZ"));
} else {
ASSERT_EQ(0, setenv("TZ", tz_name.c_str(), 1));
}
#endif
}
TEST(NextTransition, UTC) {
const auto tz = utc_time_zone();
time_zone::civil_transition trans;
auto tp = time_point<absl::time_internal::cctz::seconds>::min();
EXPECT_FALSE(tz.next_transition(tp, &trans));
tp = time_point<absl::time_internal::cctz::seconds>::max();
EXPECT_FALSE(tz.next_transition(tp, &trans));
}
TEST(PrevTransition, UTC) {
const auto tz = utc_time_zone();
time_zone::civil_transition trans;
auto tp = time_point<absl::time_internal::cctz::seconds>::max();
EXPECT_FALSE(tz.prev_transition(tp, &trans));
tp = time_point<absl::time_internal::cctz::seconds>::min();
EXPECT_FALSE(tz.prev_transition(tp, &trans));
}
TEST(NextTransition, AmericaNewYork) {
const auto tz = LoadZone("America/New_York");
time_zone::civil_transition trans;
auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
EXPECT_TRUE(tz.next_transition(tp, &trans));
EXPECT_EQ(civil_second(2018, 11, 4, 2, 0, 0), trans.from);
EXPECT_EQ(civil_second(2018, 11, 4, 1, 0, 0), trans.to);
tp = time_point<absl::time_internal::cctz::seconds>::max();
EXPECT_FALSE(tz.next_transition(tp, &trans));
tp = time_point<absl::time_internal::cctz::seconds>::min();
EXPECT_TRUE(tz.next_transition(tp, &trans));
if (trans.from == civil_second(1918, 3, 31, 2, 0, 0)) {
// It looks like the tzdata is only 32 bit (probably macOS),
// which bottoms out at 1901-12-13T20:45:52+00:00.
EXPECT_EQ(civil_second(1918, 3, 31, 3, 0, 0), trans.to);
} else {
EXPECT_EQ(civil_second(1883, 11, 18, 12, 3, 58), trans.from);
EXPECT_EQ(civil_second(1883, 11, 18, 12, 0, 0), trans.to);
}
}
TEST(PrevTransition, AmericaNewYork) {
const auto tz = LoadZone("America/New_York");
time_zone::civil_transition trans;
auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
EXPECT_TRUE(tz.prev_transition(tp, &trans));
EXPECT_EQ(civil_second(2018, 3, 11, 2, 0, 0), trans.from);
EXPECT_EQ(civil_second(2018, 3, 11, 3, 0, 0), trans.to);
tp = time_point<absl::time_internal::cctz::seconds>::min();
EXPECT_FALSE(tz.prev_transition(tp, &trans));
tp = time_point<absl::time_internal::cctz::seconds>::max();
EXPECT_TRUE(tz.prev_transition(tp, &trans));
// We have a transition but we don't know which one.
}
TEST(TimeZoneEdgeCase, AmericaNewYork) {
const time_zone tz = LoadZone("America/New_York");
// Spring 1:59:59 -> 3:00:00
auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -5 * 3600, false, "EST");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -4 * 3600, true, "EDT");
// Fall 1:59:59 -> 1:00:00
tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -4 * 3600, true, "EDT");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -5 * 3600, false, "EST");
}
TEST(TimeZoneEdgeCase, AmericaLosAngeles) {
const time_zone tz = LoadZone("America/Los_Angeles");
// Spring 1:59:59 -> 3:00:00
auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -8 * 3600, false, "PST");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -7 * 3600, true, "PDT");
// Fall 1:59:59 -> 1:00:00
tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, true, "PDT");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -8 * 3600, false, "PST");
}
TEST(TimeZoneEdgeCase, ArizonaNoTransition) {
const time_zone tz = LoadZone("America/Phoenix");
// No transition in Spring.
auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -7 * 3600, false, "MST");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 3, 10, 2, 0, 0, -7 * 3600, false, "MST");
// No transition in Fall.
tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, false, "MST");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 11, 3, 2, 0, 0, -7 * 3600, false, "MST");
}
TEST(TimeZoneEdgeCase, AsiaKathmandu) {
const time_zone tz = LoadZone("Asia/Kathmandu");
// A non-DST offset change from +0530 to +0545
//
// 504901799 == Tue, 31 Dec 1985 23:59:59 +0530 (+0530)
// 504901800 == Wed, 1 Jan 1986 00:15:00 +0545 (+0545)
auto tp = convert(civil_second(1985, 12, 31, 23, 59, 59), tz);
ExpectTime(tp, tz, 1985, 12, 31, 23, 59, 59, 5.5 * 3600, false, "+0530");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 1986, 1, 1, 0, 15, 0, 5.75 * 3600, false, "+0545");
}
TEST(TimeZoneEdgeCase, PacificChatham) {
const time_zone tz = LoadZone("Pacific/Chatham");
// One-hour DST offset changes, but at atypical values
//
// 1365256799 == Sun, 7 Apr 2013 03:44:59 +1345 (+1345)
// 1365256800 == Sun, 7 Apr 2013 02:45:00 +1245 (+1245)
auto tp = convert(civil_second(2013, 4, 7, 3, 44, 59), tz);
ExpectTime(tp, tz, 2013, 4, 7, 3, 44, 59, 13.75 * 3600, true, "+1345");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 4, 7, 2, 45, 0, 12.75 * 3600, false, "+1245");
// 1380376799 == Sun, 29 Sep 2013 02:44:59 +1245 (+1245)
// 1380376800 == Sun, 29 Sep 2013 03:45:00 +1345 (+1345)
tp = convert(civil_second(2013, 9, 29, 2, 44, 59), tz);
ExpectTime(tp, tz, 2013, 9, 29, 2, 44, 59, 12.75 * 3600, false, "+1245");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 9, 29, 3, 45, 0, 13.75 * 3600, true, "+1345");
}
TEST(TimeZoneEdgeCase, AustraliaLordHowe) {
const time_zone tz = LoadZone("Australia/Lord_Howe");
// Half-hour DST offset changes
//
// 1365260399 == Sun, 7 Apr 2013 01:59:59 +1100 (+11)
// 1365260400 == Sun, 7 Apr 2013 01:30:00 +1030 (+1030)
auto tp = convert(civil_second(2013, 4, 7, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 4, 7, 1, 59, 59, 11 * 3600, true, "+11");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 4, 7, 1, 30, 0, 10.5 * 3600, false, "+1030");
// 1380986999 == Sun, 6 Oct 2013 01:59:59 +1030 (+1030)
// 1380987000 == Sun, 6 Oct 2013 02:30:00 +1100 (+11)
tp = convert(civil_second(2013, 10, 6, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 10, 6, 1, 59, 59, 10.5 * 3600, false, "+1030");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 10, 6, 2, 30, 0, 11 * 3600, true, "+11");
}
TEST(TimeZoneEdgeCase, PacificApia) {
const time_zone tz = LoadZone("Pacific/Apia");
// At the end of December 2011, Samoa jumped forward by one day,
// skipping 30 December from the local calendar, when the nation
// moved to the west of the International Date Line.
//
// A one-day, non-DST offset change
//
// 1325239199 == Thu, 29 Dec 2011 23:59:59 -1000 (-10)
// 1325239200 == Sat, 31 Dec 2011 00:00:00 +1400 (+14)
auto tp = convert(civil_second(2011, 12, 29, 23, 59, 59), tz);
ExpectTime(tp, tz, 2011, 12, 29, 23, 59, 59, -10 * 3600, true, "-10");
EXPECT_EQ(363, get_yearday(convert(tp, tz)));
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2011, 12, 31, 0, 0, 0, 14 * 3600, true, "+14");
EXPECT_EQ(365, get_yearday(convert(tp, tz)));
}
TEST(TimeZoneEdgeCase, AfricaCairo) {
const time_zone tz = LoadZone("Africa/Cairo");
if (VersionCmp(tz, "2014c") >= 0) {
// An interesting case of midnight not existing.
//
// 1400191199 == Thu, 15 May 2014 23:59:59 +0200 (EET)
// 1400191200 == Fri, 16 May 2014 01:00:00 +0300 (EEST)
auto tp = convert(civil_second(2014, 5, 15, 23, 59, 59), tz);
ExpectTime(tp, tz, 2014, 5, 15, 23, 59, 59, 2 * 3600, false, "EET");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2014, 5, 16, 1, 0, 0, 3 * 3600, true, "EEST");
}
}
TEST(TimeZoneEdgeCase, AfricaMonrovia) {
const time_zone tz = LoadZone("Africa/Monrovia");
if (VersionCmp(tz, "2017b") >= 0) {
// Strange offset change -00:44:30 -> +00:00:00 (non-DST)
//
// 63593069 == Thu, 6 Jan 1972 23:59:59 -0044 (MMT)
// 63593070 == Fri, 7 Jan 1972 00:44:30 +0000 (GMT)
auto tp = convert(civil_second(1972, 1, 6, 23, 59, 59), tz);
ExpectTime(tp, tz, 1972, 1, 6, 23, 59, 59, -44.5 * 60, false, "MMT");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 1972, 1, 7, 0, 44, 30, 0 * 60, false, "GMT");
}
}
TEST(TimeZoneEdgeCase, AmericaJamaica) {
// Jamaica discontinued DST transitions in 1983, and is now at a
// constant -0500. This makes it an interesting edge-case target.
// Note that the 32-bit times used in a (tzh_version == 0) zoneinfo
// file cannot represent the abbreviation-only transition of 1890,
// so we ignore the abbreviation by expecting what we received.
const time_zone tz = LoadZone("America/Jamaica");
// Before the first transition.
if (!tz.version().empty() && VersionCmp(tz, "2018d") >= 0) {
// We avoid the expectations on the -18430 offset below unless we are
// certain we have commit 907241e (Fix off-by-1 error for Jamaica and
// T&C before 1913) from 2018d. TODO: Remove the "version() not empty"
// part when 2018d is generally available from /usr/share/zoneinfo.
auto tp = convert(civil_second(1889, 12, 31, 0, 0, 0), tz);
ExpectTime(tp, tz, 1889, 12, 31, 0, 0, 0, -18430, false,
tz.lookup(tp).abbr);
// Over the first (abbreviation-change only) transition.
// -2524503170 == Tue, 31 Dec 1889 23:59:59 -0507 (LMT)
// -2524503169 == Wed, 1 Jan 1890 00:00:00 -0507 (KMT)
tp = convert(civil_second(1889, 12, 31, 23, 59, 59), tz);
ExpectTime(tp, tz, 1889, 12, 31, 23, 59, 59, -18430, false,
tz.lookup(tp).abbr);
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 1890, 1, 1, 0, 0, 0, -18430, false, "KMT");
}
// Over the last (DST) transition.
// 436341599 == Sun, 30 Oct 1983 01:59:59 -0400 (EDT)
// 436341600 == Sun, 30 Oct 1983 01:00:00 -0500 (EST)
auto tp = convert(civil_second(1983, 10, 30, 1, 59, 59), tz);
ExpectTime(tp, tz, 1983, 10, 30, 1, 59, 59, -4 * 3600, true, "EDT");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 1983, 10, 30, 1, 0, 0, -5 * 3600, false, "EST");
// After the last transition.
tp = convert(civil_second(1983, 12, 31, 23, 59, 59), tz);
ExpectTime(tp, tz, 1983, 12, 31, 23, 59, 59, -5 * 3600, false, "EST");
}
TEST(TimeZoneEdgeCase, WET) {
// Cover some non-existent times within forward transitions.
const time_zone tz = LoadZone("WET");
// Before the first transition.
auto tp = convert(civil_second(1977, 1, 1, 0, 0, 0), tz);
ExpectTime(tp, tz, 1977, 1, 1, 0, 0, 0, 0, false, "WET");
// Over the first transition.
// 228877199 == Sun, 3 Apr 1977 00:59:59 +0000 (WET)
// 228877200 == Sun, 3 Apr 1977 02:00:00 +0100 (WEST)
tp = convert(civil_second(1977, 4, 3, 0, 59, 59), tz);
ExpectTime(tp, tz, 1977, 4, 3, 0, 59, 59, 0, false, "WET");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
// A non-existent time within the first transition.
time_zone::civil_lookup cl1 = tz.lookup(civil_second(1977, 4, 3, 1, 15, 0));
EXPECT_EQ(time_zone::civil_lookup::SKIPPED, cl1.kind);
ExpectTime(cl1.pre, tz, 1977, 4, 3, 2, 15, 0, 1 * 3600, true, "WEST");
ExpectTime(cl1.trans, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
ExpectTime(cl1.post, tz, 1977, 4, 3, 0, 15, 0, 0 * 3600, false, "WET");
// A non-existent time within the second forward transition.
time_zone::civil_lookup cl2 = tz.lookup(civil_second(1978, 4, 2, 1, 15, 0));
EXPECT_EQ(time_zone::civil_lookup::SKIPPED, cl2.kind);
ExpectTime(cl2.pre, tz, 1978, 4, 2, 2, 15, 0, 1 * 3600, true, "WEST");
ExpectTime(cl2.trans, tz, 1978, 4, 2, 2, 0, 0, 1 * 3600, true, "WEST");
ExpectTime(cl2.post, tz, 1978, 4, 2, 0, 15, 0, 0 * 3600, false, "WET");
}
TEST(TimeZoneEdgeCase, FixedOffsets) {
const time_zone gmtm5 = LoadZone("Etc/GMT+5"); // -0500
auto tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtm5);
ExpectTime(tp, gmtm5, 1970, 1, 1, 0, 0, 0, -5 * 3600, false, "-05");
EXPECT_EQ(chrono::system_clock::from_time_t(5 * 3600), tp);
const time_zone gmtp5 = LoadZone("Etc/GMT-5"); // +0500
tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtp5);
ExpectTime(tp, gmtp5, 1970, 1, 1, 0, 0, 0, 5 * 3600, false, "+05");
EXPECT_EQ(chrono::system_clock::from_time_t(-5 * 3600), tp);
}
TEST(TimeZoneEdgeCase, NegativeYear) {
// Tests transition from year 0 (aka 1BCE) to year -1.
const time_zone tz = utc_time_zone();
auto tp = convert(civil_second(0, 1, 1, 0, 0, 0), tz);
ExpectTime(tp, tz, 0, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
EXPECT_EQ(weekday::saturday, get_weekday(convert(tp, tz)));
tp -= absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, -1, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
EXPECT_EQ(weekday::friday, get_weekday(convert(tp, tz)));
}
TEST(TimeZoneEdgeCase, UTC32bitLimit) {
const time_zone tz = utc_time_zone();
// Limits of signed 32-bit time_t
//
// 2147483647 == Tue, 19 Jan 2038 03:14:07 +0000 (UTC)
// 2147483648 == Tue, 19 Jan 2038 03:14:08 +0000 (UTC)
auto tp = convert(civil_second(2038, 1, 19, 3, 14, 7), tz);
ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 7, 0 * 3600, false, "UTC");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 8, 0 * 3600, false, "UTC");
}
TEST(TimeZoneEdgeCase, UTC5DigitYear) {
const time_zone tz = utc_time_zone();
// Rollover to 5-digit year
//
// 253402300799 == Fri, 31 Dec 9999 23:59:59 +0000 (UTC)
// 253402300800 == Sat, 1 Jan 1000 00:00:00 +0000 (UTC)
auto tp = convert(civil_second(9999, 12, 31, 23, 59, 59), tz);
ExpectTime(tp, tz, 9999, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 10000, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
}
} // namespace cctz
} // namespace time_internal
ABSL_NAMESPACE_END
} // namespace absl
Reference in a new issue View git blame Copy permalink